C18H20NOP — CID 101051529
[(Z)-(4,4-dimethyl-1,3-oxazolidin-2-ylidene)methyl]-diphenylphosphane (PubChem CID 101051529) has the molecular formula C18H20NOP and a molecular weight of 297.34 g/mol. Its IUPAC name is [(Z)-(4,4-dimethyl-1,3-oxazolidin-2-ylidene)methyl]-diphenylphosphane.
| Compound Name | [(Z)-(4,4-dimethyl-1,3-oxazolidin-2-ylidene)methyl]-diphenylphosphane |
|---|---|
| PubChem CID | 101051529 |
| Molecular Formula | C18H20NOP |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | [(Z)-(4,4-dimethyl-1,3-oxazolidin-2-ylidene)methyl]-diphenylphosphane |
| SMILES | CC1(C)CO/C(=C\P(c2ccccc2)c2ccccc2)N1 |
| InChI | InChI=1S/C18H20NOP/c1-18(2)14-20-17(19-18)13-21(15-9-5-3-6-10-15)16-11-7-4-8-12-16/h3-13,19H,14H2,1-2H3/b17-13- |
| InChIKey | DGYPAVWRAQVKFE-LGMDPLHJSA-N |
| XLogP | 3.32 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|