C9H11NO4 — CID 142683582
carbamoyl (2E,4E)-2-methylhepta-2,4,6-trieneperoxoate (PubChem CID 142683582) has the molecular formula C9H11NO4 and a molecular weight of 197.19 g/mol. Its IUPAC name is carbamoyl (2E,4E)-2-methylhepta-2,4,6-trieneperoxoate.
| Compound Name | carbamoyl (2E,4E)-2-methylhepta-2,4,6-trieneperoxoate |
|---|---|
| PubChem CID | 142683582 |
| Molecular Formula | C9H11NO4 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | carbamoyl (2E,4E)-2-methylhepta-2,4,6-trieneperoxoate |
| SMILES | C=C/C=C/C=C(\C)C(=O)OOC(N)=O |
| InChI | InChI=1S/C9H11NO4/c1-3-4-5-6-7(2)8(11)13-14-9(10)12/h3-6H,1H2,2H3,(H2,10,12)/b5-4+,7-6+ |
| InChIKey | WVYLJYYDQZJUNX-YTXTXJHMSA-N |
| XLogP | 1.23 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|