C11H17N2O2+ — CID 88913171
1-aminoethylidene-[(1Z)-buta-1,3-dienyl]-(2,4-dioxopentan-3-yl)azanium (PubChem CID 88913171) has the molecular formula C11H17N2O2+ and a molecular weight of 209.27 g/mol. Its IUPAC name is 1-aminoethylidene-[(1Z)-buta-1,3-dienyl]-(2,4-dioxopentan-3-yl)azanium.
| Compound Name | 1-aminoethylidene-[(1Z)-buta-1,3-dienyl]-(2,4-dioxopentan-3-yl)azanium |
|---|---|
| PubChem CID | 88913171 |
| Molecular Formula | C11H17N2O2+ |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.13 |
| IUPAC Name | 1-aminoethylidene-[(1Z)-buta-1,3-dienyl]-(2,4-dioxopentan-3-yl)azanium |
| SMILES | C=C/C=C\[N+](=C(/C)N)C(C(C)=O)C(C)=O |
| InChI | InChI=1S/C11H16N2O2/c1-5-6-7-13(10(4)12)11(8(2)14)9(3)15/h5-7,11-12H,1H2,2-4H3/p+1/b7-6- |
| InChIKey | CIVAWJMLASFSHK-SREVYHEPSA-O |
| XLogP | 0.62 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|