C30H58N4O4 — CID 142691443
1-N,10-N-diheptyl-1-N,10-N-dimethyldecane-1,1,10,10-tetracarboxamide (PubChem CID 142691443) has the molecular formula C30H58N4O4 and a molecular weight of 538.82 g/mol. Its IUPAC name is 1-N,10-N-diheptyl-1-N,10-N-dimethyldecane-1,1,10,10-tetracarboxamide.
| Compound Name | 1-N,10-N-diheptyl-1-N,10-N-dimethyldecane-1,1,10,10-tetracarboxamide |
|---|---|
| PubChem CID | 142691443 |
| Molecular Formula | C30H58N4O4 |
| Molecular Weight | 538.82 g/mol |
| Exact Mass | 538.45 |
| IUPAC Name | 1-N,10-N-diheptyl-1-N,10-N-dimethyldecane-1,1,10,10-tetracarboxamide |
| SMILES | CCCCCCCN(C)C(=O)C(CCCCCCCCC(C(N)=O)C(=O)N(C)CCCCCCC)C(N)=O |
| InChI | InChI=1S/C30H58N4O4/c1-5-7-9-15-19-23-33(3)29(37)25(27(31)35)21-17-13-11-12-14-18-22-26(28(32)36)30(38)34(4)24-20-16-10-8-6-2/h25-26H,5-24H2,1-4H3,(H2,31,35)(H2,32,36) |
| InChIKey | KOLHMBYPYLLLPQ-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 126.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.82 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|