C28H27FN6 — CID 142696215
N-[2-[4-(6-fluoro-2H-indazol-3-yl)piperidin-1-yl]ethyl]-3-phenylquinoxalin-2-amine (PubChem CID 142696215) has the molecular formula C28H27FN6 and a molecular weight of 466.56 g/mol. Its IUPAC name is N-[2-[4-(6-fluoro-2H-indazol-3-yl)piperidin-1-yl]ethyl]-3-phenylquinoxalin-2-amine.
| Compound Name | N-[2-[4-(6-fluoro-2H-indazol-3-yl)piperidin-1-yl]ethyl]-3-phenylquinoxalin-2-amine |
|---|---|
| PubChem CID | 142696215 |
| Molecular Formula | C28H27FN6 |
| Molecular Weight | 466.56 g/mol |
| Exact Mass | 466.23 |
| IUPAC Name | N-[2-[4-(6-fluoro-2H-indazol-3-yl)piperidin-1-yl]ethyl]-3-phenylquinoxalin-2-amine |
| SMILES | Fc1ccc2c(C3CCN(CCNc4nc5ccccc5nc4-c4ccccc4)CC3)[nH]nc2c1 |
| InChI | InChI=1S/C28H27FN6/c29-21-10-11-22-25(18-21)33-34-26(22)20-12-15-35(16-13-20)17-14-30-28-27(19-6-2-1-3-7-19)31-23-8-4-5-9-24(23)32-28/h1-11,18,20H,12-17H2,(H,30,32)(H,33,34) |
| InChIKey | NIYDFQGNUBFUSN-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.56 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |