C16H11Cl2N3O3 — CID 142700547
phenyl N-(5,7-dichloro-3-methoxyquinoxalin-2-yl)carbamate (PubChem CID 142700547) has the molecular formula C16H11Cl2N3O3 and a molecular weight of 364.19 g/mol. Its IUPAC name is phenyl N-(5,7-dichloro-3-methoxyquinoxalin-2-yl)carbamate.
| Compound Name | phenyl N-(5,7-dichloro-3-methoxyquinoxalin-2-yl)carbamate |
|---|---|
| PubChem CID | 142700547 |
| Molecular Formula | C16H11Cl2N3O3 |
| Molecular Weight | 364.19 g/mol |
| Exact Mass | 363.02 |
| IUPAC Name | phenyl N-(5,7-dichloro-3-methoxyquinoxalin-2-yl)carbamate |
| SMILES | COc1nc2c(Cl)cc(Cl)cc2nc1NC(=O)Oc1ccccc1 |
| InChI | InChI=1S/C16H11Cl2N3O3/c1-23-15-14(21-16(22)24-10-5-3-2-4-6-10)19-12-8-9(17)7-11(18)13(12)20-15/h2-8H,1H3,(H,19,21,22) |
| InChIKey | RXYJKFUPHUOHFU-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.19 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |