C12H7O5P — CID 142700764
1-oxo-7-phenyl-2,9,10-trioxa-1λ5-phosphatricyclo[4.3.1.03,8]deca-3(8),4,6-trien-4-ol (PubChem CID 142700764) has the molecular formula C12H7O5P and a molecular weight of 262.16 g/mol. Its IUPAC name is 1-oxo-7-phenyl-2,9,10-trioxa-1λ5-phosphatricyclo[4.3.1.03,8]deca-3(8),4,6-trien-4-ol.
| Compound Name | 1-oxo-7-phenyl-2,9,10-trioxa-1λ5-phosphatricyclo[4.3.1.03,8]deca-3(8),4,6-trien-4-ol |
|---|---|
| PubChem CID | 142700764 |
| Molecular Formula | C12H7O5P |
| Molecular Weight | 262.16 g/mol |
| Exact Mass | 262.00 |
| IUPAC Name | 1-oxo-7-phenyl-2,9,10-trioxa-1λ5-phosphatricyclo[4.3.1.03,8]deca-3(8),4,6-trien-4-ol |
| SMILES | O=P12Oc3cc(O)c(c(c3-c3ccccc3)O1)O2 |
| InChI | InChI=1S/C12H7O5P/c13-8-6-9-10(7-4-2-1-3-5-7)12-11(8)16-18(14,15-9)17-12/h1-6,13H |
| InChIKey | HCEQBWRYXRPBEE-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.16 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|