C22H35N3S — CID 142703234
N-[2-(2-cyclohexylimino-3-methyl-1,3-thiazol-4-yl)ethyl]adamantan-1-amine (PubChem CID 142703234) has the molecular formula C22H35N3S and a molecular weight of 373.61 g/mol. Its IUPAC name is N-[2-(2-cyclohexylimino-3-methyl-1,3-thiazol-4-yl)ethyl]adamantan-1-amine.
| Compound Name | N-[2-(2-cyclohexylimino-3-methyl-1,3-thiazol-4-yl)ethyl]adamantan-1-amine |
|---|---|
| PubChem CID | 142703234 |
| Molecular Formula | C22H35N3S |
| Molecular Weight | 373.61 g/mol |
| Exact Mass | 373.26 |
| IUPAC Name | N-[2-(2-cyclohexylimino-3-methyl-1,3-thiazol-4-yl)ethyl]adamantan-1-amine |
| SMILES | Cn1c(CCNC23CC4CC(CC(C4)C2)C3)cs/c1=N\C1CCCCC1 |
| InChI | InChI=1S/C22H35N3S/c1-25-20(15-26-21(25)24-19-5-3-2-4-6-19)7-8-23-22-12-16-9-17(13-22)11-18(10-16)14-22/h15-19,23H,2-14H2,1H3/b24-21- |
| InChIKey | YVNOOYNWBSQLFZ-FLFQWRMESA-N |
| XLogP | 4.42 |
| TPSA | 29.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.61 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|