C63H56N6O5 — CID 142706703
bis[2-methyl-1-[3-(4-phenyl-3-phenylmethoxyphenyl)-1-pyridin-2-ylpyrazol-5-yl]propan-2-yl] carbonate (PubChem CID 142706703) has the molecular formula C63H56N6O5 and a molecular weight of 977.18 g/mol. Its IUPAC name is bis[2-methyl-1-[3-(4-phenyl-3-phenylmethoxyphenyl)-1-pyridin-2-ylpyrazol-5-yl]propan-2-yl] carbonate.
| Compound Name | bis[2-methyl-1-[3-(4-phenyl-3-phenylmethoxyphenyl)-1-pyridin-2-ylpyrazol-5-yl]propan-2-yl] carbonate |
|---|---|
| PubChem CID | 142706703 |
| Molecular Formula | C63H56N6O5 |
| Molecular Weight | 977.18 g/mol |
| Exact Mass | 976.43 |
| IUPAC Name | bis[2-methyl-1-[3-(4-phenyl-3-phenylmethoxyphenyl)-1-pyridin-2-ylpyrazol-5-yl]propan-2-yl] carbonate |
| SMILES | CC(C)(Cc1cc(-c2ccc(-c3ccccc3)c(OCc3ccccc3)c2)nn1-c1ccccn1)OC(=O)OC(C)(C)Cc1cc(-c2ccc(-c3ccccc3)c(OCc3ccccc3)c2)nn1-c1ccccn1 |
| InChI | InChI=1S/C63H56N6O5/c1-62(2,41-51-39-55(66-68(51)59-29-17-19-35-64-59)49-31-33-53(47-25-13-7-14-26-47)57(37-49)71-43-45-21-9-5-10-22-45)73-61(70)74-63(3,4)42-52-40-56(67-69(52)60-30-18-20-36-65-60)50-32-34-54(48-27-15-8-16-28-48)58(38-50)72-44-46-23-11-6-12-24-46/h5-40H,41-44H2,1-4H3 |
| InChIKey | OPOGOZYTMVIEBI-UHFFFAOYSA-N |
| XLogP | 14.17 |
| TPSA | 115.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 74 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 977.18 |
| LogP ≤ 5 | 14.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |