C16H32O5Si — CID 142708381
hydroxy-(2-methylpropyl)-bis[3-(oxiran-2-ylmethoxy)propyl]silane (PubChem CID 142708381) has the molecular formula C16H32O5Si and a molecular weight of 332.51 g/mol. Its IUPAC name is hydroxy-(2-methylpropyl)-bis[3-(oxiran-2-ylmethoxy)propyl]silane.
| Compound Name | hydroxy-(2-methylpropyl)-bis[3-(oxiran-2-ylmethoxy)propyl]silane |
|---|---|
| PubChem CID | 142708381 |
| Molecular Formula | C16H32O5Si |
| Molecular Weight | 332.51 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | hydroxy-(2-methylpropyl)-bis[3-(oxiran-2-ylmethoxy)propyl]silane |
| SMILES | CC(C)C[Si](O)(CCCOCC1CO1)CCCOCC1CO1 |
| InChI | InChI=1S/C16H32O5Si/c1-14(2)13-22(17,7-3-5-18-9-15-11-20-15)8-4-6-19-10-16-12-21-16/h14-17H,3-13H2,1-2H3 |
| InChIKey | XPJXORGQTHALAA-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 63.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.51 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|