C22H22O2 — CID 142711855
1-[6-(3,5-dimethylphenoxy)hexa-2,4-diynoxy]-3,5-dimethylbenzene (PubChem CID 142711855) has the molecular formula C22H22O2 and a molecular weight of 318.42 g/mol. Its IUPAC name is 1-[6-(3,5-dimethylphenoxy)hexa-2,4-diynoxy]-3,5-dimethylbenzene.
| Compound Name | 1-[6-(3,5-dimethylphenoxy)hexa-2,4-diynoxy]-3,5-dimethylbenzene |
|---|---|
| PubChem CID | 142711855 |
| Molecular Formula | C22H22O2 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | 1-[6-(3,5-dimethylphenoxy)hexa-2,4-diynoxy]-3,5-dimethylbenzene |
| SMILES | Cc1cc(C)cc(OCC#CC#CCOc2cc(C)cc(C)c2)c1 |
| InChI | InChI=1S/C22H22O2/c1-17-11-18(2)14-21(13-17)23-9-7-5-6-8-10-24-22-15-19(3)12-20(4)16-22/h11-16H,9-10H2,1-4H3 |
| InChIKey | NQCLSRRCLKYORV-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|