C77H84O2 — CID 157373203
1-[6-[4-[bis(4-tert-butylphenyl)-(4-methylphenyl)methyl]phenoxy]hexa-2,4-diynoxy]-4-[tris(4-tert-butylphenyl)methyl]benzene (PubChem CID 157373203) has the molecular formula C77H84O2 and a molecular weight of 1041.52 g/mol. Its IUPAC name is 1-[6-[4-[bis(4-tert-butylphenyl)-(4-methylphenyl)methyl]phenoxy]hexa-2,4-diynoxy]-4-[tris(4-tert-butylphenyl)methyl]benzene.
| Compound Name | 1-[6-[4-[bis(4-tert-butylphenyl)-(4-methylphenyl)methyl]phenoxy]hexa-2,4-diynoxy]-4-[tris(4-tert-butylphenyl)methyl]benzene |
|---|---|
| PubChem CID | 157373203 |
| Molecular Formula | C77H84O2 |
| Molecular Weight | 1041.52 g/mol |
| Exact Mass | 1040.65 |
| IUPAC Name | 1-[6-[4-[bis(4-tert-butylphenyl)-(4-methylphenyl)methyl]phenoxy]hexa-2,4-diynoxy]-4-[tris(4-tert-butylphenyl)methyl]benzene |
| SMILES | Cc1ccc(C(c2ccc(OCC#CC#CCOc3ccc(C(c4ccc(C(C)(C)C)cc4)(c4ccc(C(C)(C)C)cc4)c4ccc(C(C)(C)C)cc4)cc3)cc2)(c2ccc(C(C)(C)C)cc2)c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C77H84O2/c1-55-21-23-61(24-22-55)76(62-35-25-56(26-36-62)71(2,3)4,63-37-27-57(28-38-63)72(5,6)7)67-45-49-69(50-46-67)78-53-19-17-18-20-54-79-70-51-47-68(48-52-70)77(64-39-29-58(30-40-64)73(8,9)10,65-41-31-59(32-42-65)74(11,12)13)66-43-33-60(34-44-66)75(14,15)16/h21-52H,53-54H2,1-16H3 |
| InChIKey | KQTIHRORBWPMFF-UHFFFAOYSA-N |
| XLogP | 18.71 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 79 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1041.52 |
| LogP ≤ 5 | 18.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|