About N,1-dimethyl-3,4-bis(trifluoromethyl)pyrazole-5-carboxamide
N,1-dimethyl-3,4-bis(trifluoromethyl)pyrazole-5-carboxamide (PubChem CID 142717358) has the molecular formula C8H7F6N3O
and a molecular weight of 275.15 g/mol. Its IUPAC name is N,1-dimethyl-3,4-bis(trifluoromethyl)pyrazole-5-carboxamide.
Molecular Properties
| Compound Name | N,1-dimethyl-3,4-bis(trifluoromethyl)pyrazole-5-carboxamide |
| PubChem CID | 142717358 |
| Molecular Formula | C8H7F6N3O |
| Molecular Weight | 275.15 g/mol |
| Exact Mass | 275.05 |
| IUPAC Name | N,1-dimethyl-3,4-bis(trifluoromethyl)pyrazole-5-carboxamide |
| SMILES | CNC(=O)c1c(C(F)(F)F)c(C(F)(F)F)nn1C |
| InChI | InChI=1S/C8H7F6N3O/c1-15-6(18)4-3(7(9,10)11)5(8(12,13)14)16-17(4)2/h1-2H3,(H,15,18) |
| InChIKey | LNUOSBLOMSJTNA-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.15 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N,1-dimethyl-3,4-bis(trifluoromethyl)pyrazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,1-dimethyl-3,4-bis(trifluoromethyl)pyrazole-5-carboxamide?
The IUPAC name of N,1-dimethyl-3,4-bis(trifluoromethyl)pyrazole-5-carboxamide (CID 142717358) is N,1-dimethyl-3,4-bis(trifluoromethyl)pyrazole-5-carboxamide.
What is the SMILES notation for N,1-dimethyl-3,4-bis(trifluoromethyl)pyrazole-5-carboxamide?
The canonical SMILES for N,1-dimethyl-3,4-bis(trifluoromethyl)pyrazole-5-carboxamide is CNC(=O)c1c(C(F)(F)F)c(C(F)(F)F)nn1C.
What is the InChIKey of N,1-dimethyl-3,4-bis(trifluoromethyl)pyrazole-5-carboxamide?
The InChIKey is LNUOSBLOMSJTNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7F6N3O/c1-15-6(18)4-3(7(9,10)11)5(8(12,13)14)16-17(4)2/h1-2H3,(H,15,18).
What are the key properties of N,1-dimethyl-3,4-bis(trifluoromethyl)pyrazole-5-carboxamide?
N,1-dimethyl-3,4-bis(trifluoromethyl)pyrazole-5-carboxamide has a molecular weight of 275.15 g/mol, XLogP of 1.82, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,1-dimethyl-3,4-bis(trifluoromethyl)pyrazole-5-carboxamide is sourced from PubChem (CID 142717358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).