C20H23NO7S — CID 142723173
methyl 2-[[(E)-3-(3,4-diacetyloxyphenyl)prop-2-enoyl]amino]-3-prop-2-enylsulfanylpropanoate (PubChem CID 142723173) has the molecular formula C20H23NO7S and a molecular weight of 421.47 g/mol. Its IUPAC name is methyl 2-[[(E)-3-(3,4-diacetyloxyphenyl)prop-2-enoyl]amino]-3-prop-2-enylsulfanylpropanoate.
| Compound Name | methyl 2-[[(E)-3-(3,4-diacetyloxyphenyl)prop-2-enoyl]amino]-3-prop-2-enylsulfanylpropanoate |
|---|---|
| PubChem CID | 142723173 |
| Molecular Formula | C20H23NO7S |
| Molecular Weight | 421.47 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | methyl 2-[[(E)-3-(3,4-diacetyloxyphenyl)prop-2-enoyl]amino]-3-prop-2-enylsulfanylpropanoate |
| SMILES | C=CCSCC(NC(=O)/C=C/c1ccc(OC(C)=O)c(OC(C)=O)c1)C(=O)OC |
| InChI | InChI=1S/C20H23NO7S/c1-5-10-29-12-16(20(25)26-4)21-19(24)9-7-15-6-8-17(27-13(2)22)18(11-15)28-14(3)23/h5-9,11,16H,1,10,12H2,2-4H3,(H,21,24)/b9-7+ |
| InChIKey | PBKZPNJYTITYKJ-VQHVLOKHSA-N |
| XLogP | 2.13 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.47 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|