C20H27NO7S — CID 142723175
propan-2-yl 2-[(4-acetyloxy-3,5-dimethoxybenzoyl)amino]-3-prop-2-enylsulfanylpropanoate (PubChem CID 142723175) has the molecular formula C20H27NO7S and a molecular weight of 425.50 g/mol. Its IUPAC name is propan-2-yl 2-[(4-acetyloxy-3,5-dimethoxybenzoyl)amino]-3-prop-2-enylsulfanylpropanoate.
| Compound Name | propan-2-yl 2-[(4-acetyloxy-3,5-dimethoxybenzoyl)amino]-3-prop-2-enylsulfanylpropanoate |
|---|---|
| PubChem CID | 142723175 |
| Molecular Formula | C20H27NO7S |
| Molecular Weight | 425.50 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | propan-2-yl 2-[(4-acetyloxy-3,5-dimethoxybenzoyl)amino]-3-prop-2-enylsulfanylpropanoate |
| SMILES | C=CCSCC(NC(=O)c1cc(OC)c(OC(C)=O)c(OC)c1)C(=O)OC(C)C |
| InChI | InChI=1S/C20H27NO7S/c1-7-8-29-11-15(20(24)27-12(2)3)21-19(23)14-9-16(25-5)18(28-13(4)22)17(10-14)26-6/h7,9-10,12,15H,1,8,11H2,2-6H3,(H,21,23) |
| InChIKey | OEYJVHSDVXXNRL-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.50 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|