C14H20N2O4S — CID 61119501
N-(1-amino-1-sulfanylidenebutan-2-yl)-3,4,5-trimethoxybenzamide (PubChem CID 61119501) has the molecular formula C14H20N2O4S and a molecular weight of 312.39 g/mol. Its IUPAC name is N-(1-amino-1-sulfanylidenebutan-2-yl)-3,4,5-trimethoxybenzamide.
| Compound Name | N-(1-amino-1-sulfanylidenebutan-2-yl)-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 61119501 |
| Molecular Formula | C14H20N2O4S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | N-(1-amino-1-sulfanylidenebutan-2-yl)-3,4,5-trimethoxybenzamide |
| SMILES | CCC(NC(=O)c1cc(OC)c(OC)c(OC)c1)C(N)=S |
| InChI | InChI=1S/C14H20N2O4S/c1-5-9(13(15)21)16-14(17)8-6-10(18-2)12(20-4)11(7-8)19-3/h6-7,9H,5H2,1-4H3,(H2,15,21)(H,16,17) |
| InChIKey | FPIGLXMEYSXGGW-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|