C6H14N4O2 — CID 142726582
(2S)-5-amino-2-(deuteriocarbamoylamino)pentanamide (PubChem CID 142726582) has the molecular formula C6H14N4O2 and a molecular weight of 175.21 g/mol. Its IUPAC name is (2S)-5-amino-2-(deuteriocarbamoylamino)pentanamide.
| Compound Name | (2S)-5-amino-2-(deuteriocarbamoylamino)pentanamide |
|---|---|
| PubChem CID | 142726582 |
| Molecular Formula | C6H14N4O2 |
| Molecular Weight | 175.21 g/mol |
| Exact Mass | 175.12 |
| IUPAC Name | (2S)-5-amino-2-(deuteriocarbamoylamino)pentanamide |
| SMILES | [2H]NC(=O)N[C@@H](CCCN)C(N)=O |
| InChI | InChI=1S/C6H14N4O2/c7-3-1-2-4(5(8)11)10-6(9)12/h4H,1-3,7H2,(H2,8,11)(H3,9,10,12)/t4-/m0/s1/i/hD |
| InChIKey | MKBNTNWGBXFGRD-YZRVCBOHSA-N |
| XLogP | -1.75 |
| TPSA | 124.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.21 |
| LogP ≤ 5 | -1.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |