C15H18N4O3 — CID 142733469
6-(benzylamino)-5-[(E)-methoxyiminomethyl]-1,3-dimethylpyrimidine-2,4-dione (PubChem CID 142733469) has the molecular formula C15H18N4O3 and a molecular weight of 302.33 g/mol. Its IUPAC name is 6-(benzylamino)-5-[(E)-methoxyiminomethyl]-1,3-dimethylpyrimidine-2,4-dione.
| Compound Name | 6-(benzylamino)-5-[(E)-methoxyiminomethyl]-1,3-dimethylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 142733469 |
| Molecular Formula | C15H18N4O3 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 6-(benzylamino)-5-[(E)-methoxyiminomethyl]-1,3-dimethylpyrimidine-2,4-dione |
| SMILES | CO/N=C/c1c(NCc2ccccc2)n(C)c(=O)n(C)c1=O |
| InChI | InChI=1S/C15H18N4O3/c1-18-13(16-9-11-7-5-4-6-8-11)12(10-17-22-3)14(20)19(2)15(18)21/h4-8,10,16H,9H2,1-3H3/b17-10+ |
| InChIKey | NFPLHNDLRFNXIG-LICLKQGHSA-N |
| XLogP | 0.68 |
| TPSA | 77.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|