C13H14IN3O2 — CID 72696483
6-(benzylamino)-5-iodo-1,3-dimethylpyrimidine-2,4-dione (PubChem CID 72696483) has the molecular formula C13H14IN3O2 and a molecular weight of 371.18 g/mol. Its IUPAC name is 6-(benzylamino)-5-iodo-1,3-dimethylpyrimidine-2,4-dione.
| Compound Name | 6-(benzylamino)-5-iodo-1,3-dimethylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 72696483 |
| Molecular Formula | C13H14IN3O2 |
| Molecular Weight | 371.18 g/mol |
| Exact Mass | 371.01 |
| IUPAC Name | 6-(benzylamino)-5-iodo-1,3-dimethylpyrimidine-2,4-dione |
| SMILES | Cn1c(NCc2ccccc2)c(I)c(=O)n(C)c1=O |
| InChI | InChI=1S/C13H14IN3O2/c1-16-11(10(14)12(18)17(2)13(16)19)15-8-9-6-4-3-5-7-9/h3-7,15H,8H2,1-2H3 |
| InChIKey | HLJSTXAYKZPMHO-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 56.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.18 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|