C12H14N4O2 — CID 15665558
5-amino-6-(benzylamino)-3-methyl-1H-pyrimidine-2,4-dione (PubChem CID 15665558) has the molecular formula C12H14N4O2 and a molecular weight of 246.27 g/mol. Its IUPAC name is 5-amino-6-(benzylamino)-3-methyl-1H-pyrimidine-2,4-dione.
| Compound Name | 5-amino-6-(benzylamino)-3-methyl-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 15665558 |
| Molecular Formula | C12H14N4O2 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | 5-amino-6-(benzylamino)-3-methyl-1H-pyrimidine-2,4-dione |
| SMILES | Cn1c(=O)[nH]c(NCc2ccccc2)c(N)c1=O |
| InChI | InChI=1S/C12H14N4O2/c1-16-11(17)9(13)10(15-12(16)18)14-7-8-5-3-2-4-6-8/h2-6,14H,7,13H2,1H3,(H,15,18) |
| InChIKey | YOGBMLYUJJVOAM-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 92.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |