C10H9BrO3 — CID 142737162
2-bromo-5,6-dimethoxy-1-benzofuran (PubChem CID 142737162) has the molecular formula C10H9BrO3 and a molecular weight of 257.08 g/mol. Its IUPAC name is 2-bromo-5,6-dimethoxy-1-benzofuran.
| Compound Name | 2-bromo-5,6-dimethoxy-1-benzofuran |
|---|---|
| PubChem CID | 142737162 |
| Molecular Formula | C10H9BrO3 |
| Molecular Weight | 257.08 g/mol |
| Exact Mass | 255.97 |
| IUPAC Name | 2-bromo-5,6-dimethoxy-1-benzofuran |
| SMILES | COc1cc2cc(Br)oc2cc1OC |
| InChI | InChI=1S/C10H9BrO3/c1-12-8-3-6-4-10(11)14-7(6)5-9(8)13-2/h3-5H,1-2H3 |
| InChIKey | RZTWJWHTALGLNK-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 31.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.08 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |