C17H13F3N2OS2 — CID 142739255
S-[[7-[4-(trifluoromethyl)phenyl]-1,2-benzothiazol-6-yl]] N,N-dimethylcarbamothioate (PubChem CID 142739255) has the molecular formula C17H13F3N2OS2 and a molecular weight of 382.43 g/mol. Its IUPAC name is S-[[7-[4-(trifluoromethyl)phenyl]-1,2-benzothiazol-6-yl]] N,N-dimethylcarbamothioate.
| Compound Name | S-[[7-[4-(trifluoromethyl)phenyl]-1,2-benzothiazol-6-yl]] N,N-dimethylcarbamothioate |
|---|---|
| PubChem CID | 142739255 |
| Molecular Formula | C17H13F3N2OS2 |
| Molecular Weight | 382.43 g/mol |
| Exact Mass | 382.04 |
| IUPAC Name | S-[[7-[4-(trifluoromethyl)phenyl]-1,2-benzothiazol-6-yl]] N,N-dimethylcarbamothioate |
| SMILES | CN(C)C(=O)Sc1ccc2cnsc2c1-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H13F3N2OS2/c1-22(2)16(23)24-13-8-5-11-9-21-25-15(11)14(13)10-3-6-12(7-4-10)17(18,19)20/h3-9H,1-2H3 |
| InChIKey | GVNZLJQJKMJSKZ-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.43 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|