C9H8F3N3 — CID 142739937
1,2,3-trifluoro-4-phenyl-4H-triazine (PubChem CID 142739937) has the molecular formula C9H8F3N3 and a molecular weight of 215.18 g/mol. Its IUPAC name is 1,2,3-trifluoro-4-phenyl-4H-triazine.
| Compound Name | 1,2,3-trifluoro-4-phenyl-4H-triazine |
|---|---|
| PubChem CID | 142739937 |
| Molecular Formula | C9H8F3N3 |
| Molecular Weight | 215.18 g/mol |
| Exact Mass | 215.07 |
| IUPAC Name | 1,2,3-trifluoro-4-phenyl-4H-triazine |
| SMILES | FN1C=CC(c2ccccc2)N(F)N1F |
| InChI | InChI=1S/C9H8F3N3/c10-13-7-6-9(14(11)15(13)12)8-4-2-1-3-5-8/h1-7,9H |
| InChIKey | PBQRDWWMKNRVJB-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.18 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|