About [2-(diethyl-λ3-iodanyl)phenyl]-phenylmethanone
[2-(diethyl-λ3-iodanyl)phenyl]-phenylmethanone (PubChem CID 142740893) has the molecular formula C17H19IO
and a molecular weight of 366.24 g/mol. Its IUPAC name is [2-(diethyl-λ3-iodanyl)phenyl]-phenylmethanone.
Molecular Properties
| Compound Name | [2-(diethyl-λ3-iodanyl)phenyl]-phenylmethanone |
| PubChem CID | 142740893 |
| Molecular Formula | C17H19IO |
| Molecular Weight | 366.24 g/mol |
| Exact Mass | 366.05 |
| IUPAC Name | [2-(diethyl-λ3-iodanyl)phenyl]-phenylmethanone |
| SMILES | CCI(CC)c1ccccc1C(=O)c1ccccc1 |
| InChI | InChI=1S/C17H19IO/c1-3-18(4-2)16-13-9-8-12-15(16)17(19)14-10-6-5-7-11-14/h5-13H,3-4H2,1-2H3 |
| InChIKey | WWTYPGLFIQLNCP-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.24 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze [2-(diethyl-λ3-iodanyl)phenyl]-phenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(diethyl-λ3-iodanyl)phenyl]-phenylmethanone?
The IUPAC name of [2-(diethyl-λ3-iodanyl)phenyl]-phenylmethanone (CID 142740893) is [2-(diethyl-λ3-iodanyl)phenyl]-phenylmethanone.
What is the SMILES notation for [2-(diethyl-λ3-iodanyl)phenyl]-phenylmethanone?
The canonical SMILES for [2-(diethyl-λ3-iodanyl)phenyl]-phenylmethanone is CCI(CC)c1ccccc1C(=O)c1ccccc1.
What is the InChIKey of [2-(diethyl-λ3-iodanyl)phenyl]-phenylmethanone?
The InChIKey is WWTYPGLFIQLNCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19IO/c1-3-18(4-2)16-13-9-8-12-15(16)17(19)14-10-6-5-7-11-14/h5-13H,3-4H2,1-2H3.
What are the key properties of [2-(diethyl-λ3-iodanyl)phenyl]-phenylmethanone?
[2-(diethyl-λ3-iodanyl)phenyl]-phenylmethanone has a molecular weight of 366.24 g/mol, XLogP of 4.63, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(diethyl-λ3-iodanyl)phenyl]-phenylmethanone is sourced from PubChem (CID 142740893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).