C15H22N4O2 — CID 142742097
1-[4-(4-amino-2-methyl-5-propan-2-yloxyphenyl)-5,6-dihydro-1,2,4-triazin-1-yl]ethanone (PubChem CID 142742097) has the molecular formula C15H22N4O2 and a molecular weight of 290.37 g/mol. Its IUPAC name is 1-[4-(4-amino-2-methyl-5-propan-2-yloxyphenyl)-5,6-dihydro-1,2,4-triazin-1-yl]ethanone.
| Compound Name | 1-[4-(4-amino-2-methyl-5-propan-2-yloxyphenyl)-5,6-dihydro-1,2,4-triazin-1-yl]ethanone |
|---|---|
| PubChem CID | 142742097 |
| Molecular Formula | C15H22N4O2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | 1-[4-(4-amino-2-methyl-5-propan-2-yloxyphenyl)-5,6-dihydro-1,2,4-triazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(c2cc(OC(C)C)c(N)cc2C)C=N1 |
| InChI | InChI=1S/C15H22N4O2/c1-10(2)21-15-8-14(11(3)7-13(15)16)18-5-6-19(12(4)20)17-9-18/h7-10H,5-6,16H2,1-4H3 |
| InChIKey | MELRNKYAWDWOAV-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 71.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|