C11H18N4O6S3 — CID 142745805
2-amino-5-[[1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-2-(dithiocarboxyamino)-5-oxopentanoic acid (PubChem CID 142745805) has the molecular formula C11H18N4O6S3 and a molecular weight of 398.49 g/mol. Its IUPAC name is 2-amino-5-[[1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-2-(dithiocarboxyamino)-5-oxopentanoic acid.
| Compound Name | 2-amino-5-[[1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-2-(dithiocarboxyamino)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 142745805 |
| Molecular Formula | C11H18N4O6S3 |
| Molecular Weight | 398.49 g/mol |
| Exact Mass | 398.04 |
| IUPAC Name | 2-amino-5-[[1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-2-(dithiocarboxyamino)-5-oxopentanoic acid |
| SMILES | NC(CCC(=O)NC(CS)C(=O)NCC(=O)O)(NC(=S)S)C(=O)O |
| InChI | InChI=1S/C11H18N4O6S3/c12-11(9(20)21,15-10(23)24)2-1-6(16)14-5(4-22)8(19)13-3-7(17)18/h5,22H,1-4,12H2,(H,13,19)(H,14,16)(H,17,18)(H,20,21)(H2,15,23,24) |
| InChIKey | CFGKLRNUAOZVJT-UHFFFAOYSA-N |
| XLogP | -2.07 |
| TPSA | 170.85 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.49 |
| LogP ≤ 5 | -2.07 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|