C5H9N3O5 — CID 142746760
(3S,4S,5S)-5-[azido(hydroxy)methyl]oxolane-2,3,4-triol (PubChem CID 142746760) has the molecular formula C5H9N3O5 and a molecular weight of 191.14 g/mol. Its IUPAC name is (3S,4S,5S)-5-[azido(hydroxy)methyl]oxolane-2,3,4-triol.
| Compound Name | (3S,4S,5S)-5-[azido(hydroxy)methyl]oxolane-2,3,4-triol |
|---|---|
| PubChem CID | 142746760 |
| Molecular Formula | C5H9N3O5 |
| Molecular Weight | 191.14 g/mol |
| Exact Mass | 191.05 |
| IUPAC Name | (3S,4S,5S)-5-[azido(hydroxy)methyl]oxolane-2,3,4-triol |
| SMILES | [N-]=[N+]=NC(O)[C@H]1OC(O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C5H9N3O5/c6-8-7-4(11)3-1(9)2(10)5(12)13-3/h1-5,9-12H/t1-,2-,3-,4?,5?/m0/s1 |
| InChIKey | HSOUSBKRUWXFQB-IQJZEPRVSA-N |
| XLogP | -1.95 |
| TPSA | 138.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.14 |
| LogP ≤ 5 | -1.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|