C31H36O4 — CID 142747956
bis(3,4-diethylphenyl) 7,7-dimethylbicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate (PubChem CID 142747956) has the molecular formula C31H36O4 and a molecular weight of 472.63 g/mol. Its IUPAC name is bis(3,4-diethylphenyl) 7,7-dimethylbicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate.
| Compound Name | bis(3,4-diethylphenyl) 7,7-dimethylbicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 142747956 |
| Molecular Formula | C31H36O4 |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 472.26 |
| IUPAC Name | bis(3,4-diethylphenyl) 7,7-dimethylbicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate |
| SMILES | CCc1ccc(OC(=O)C2=C(C(=O)Oc3ccc(CC)c(CC)c3)C3C=CC2C3(C)C)cc1CC |
| InChI | InChI=1S/C31H36O4/c1-7-19-11-13-23(17-21(19)9-3)34-29(32)27-25-15-16-26(31(25,5)6)28(27)30(33)35-24-14-12-20(8-2)22(10-4)18-24/h11-18,25-26H,7-10H2,1-6H3 |
| InChIKey | VXRQKZZUMAQMON-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|