C39H56O4 — CID 142748009
bis(1,5,6-tripropylcyclohexa-2,4-dien-1-yl) bicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate (PubChem CID 142748009) has the molecular formula C39H56O4 and a molecular weight of 588.87 g/mol. Its IUPAC name is bis(1,5,6-tripropylcyclohexa-2,4-dien-1-yl) bicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate.
| Compound Name | bis(1,5,6-tripropylcyclohexa-2,4-dien-1-yl) bicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 142748009 |
| Molecular Formula | C39H56O4 |
| Molecular Weight | 588.87 g/mol |
| Exact Mass | 588.42 |
| IUPAC Name | bis(1,5,6-tripropylcyclohexa-2,4-dien-1-yl) bicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate |
| SMILES | CCCC1=CC=CC(CCC)(OC(=O)C2=C(C(=O)OC3(CCC)C=CC=C(CCC)C3CCC)C3C=CC2C3)C1CCC |
| InChI | InChI=1S/C39H56O4/c1-7-15-28-19-13-25-38(23-11-5,32(28)17-9-3)42-36(40)34-30-21-22-31(27-30)35(34)37(41)43-39(24-12-6)26-14-20-29(16-8-2)33(39)18-10-4/h13-14,19-22,25-26,30-33H,7-12,15-18,23-24,27H2,1-6H3 |
| InChIKey | KSAHELWIGCHNGR-UHFFFAOYSA-N |
| XLogP | 10.08 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.87 |
| LogP ≤ 5 | 10.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|