C33H44O4 — CID 142748194
bis(1,3,6-triethylcyclohexa-2,4-dien-1-yl) bicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate (PubChem CID 142748194) has the molecular formula C33H44O4 and a molecular weight of 504.71 g/mol. Its IUPAC name is bis(1,3,6-triethylcyclohexa-2,4-dien-1-yl) bicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate.
| Compound Name | bis(1,3,6-triethylcyclohexa-2,4-dien-1-yl) bicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 142748194 |
| Molecular Formula | C33H44O4 |
| Molecular Weight | 504.71 g/mol |
| Exact Mass | 504.32 |
| IUPAC Name | bis(1,3,6-triethylcyclohexa-2,4-dien-1-yl) bicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate |
| SMILES | CCC1=CC(CC)(OC(=O)C2=C(C(=O)OC3(CC)C=C(CC)C=CC3CC)C3C=CC2C3)C(CC)C=C1 |
| InChI | InChI=1S/C33H44O4/c1-7-22-13-17-26(9-3)32(11-5,20-22)36-30(34)28-24-15-16-25(19-24)29(28)31(35)37-33(12-6)21-23(8-2)14-18-27(33)10-4/h13-18,20-21,24-27H,7-12,19H2,1-6H3 |
| InChIKey | SJFNNKMEHFMRFD-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.71 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|