C31H40O4 — CID 142748213
bis(1,3-diethylcyclohexa-2,4-dien-1-yl) 7,7-dimethylbicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate (PubChem CID 142748213) has the molecular formula C31H40O4 and a molecular weight of 476.66 g/mol. Its IUPAC name is bis(1,3-diethylcyclohexa-2,4-dien-1-yl) 7,7-dimethylbicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate.
| Compound Name | bis(1,3-diethylcyclohexa-2,4-dien-1-yl) 7,7-dimethylbicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 142748213 |
| Molecular Formula | C31H40O4 |
| Molecular Weight | 476.66 g/mol |
| Exact Mass | 476.29 |
| IUPAC Name | bis(1,3-diethylcyclohexa-2,4-dien-1-yl) 7,7-dimethylbicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate |
| SMILES | CCC1=CC(CC)(OC(=O)C2=C(C(=O)OC3(CC)C=C(CC)C=CC3)C3C=CC2C3(C)C)CC=C1 |
| InChI | InChI=1S/C31H40O4/c1-7-21-13-11-17-30(9-3,19-21)34-27(32)25-23-15-16-24(29(23,5)6)26(25)28(33)35-31(10-4)18-12-14-22(8-2)20-31/h11-16,19-20,23-24H,7-10,17-18H2,1-6H3 |
| InChIKey | ZSTQITLJKQGLPO-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.66 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|