C35H50O4 — CID 142748136
bis(1,3-dipropylcyclohexa-2,4-dien-1-yl) 7,7-dimethylbicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate (PubChem CID 142748136) has the molecular formula C35H50O4 and a molecular weight of 534.78 g/mol. Its IUPAC name is bis(1,3-dipropylcyclohexa-2,4-dien-1-yl) 7,7-dimethylbicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate.
| Compound Name | bis(1,3-dipropylcyclohexa-2,4-dien-1-yl) 7,7-dimethylbicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 142748136 |
| Molecular Formula | C35H50O4 |
| Molecular Weight | 534.78 g/mol |
| Exact Mass | 534.37 |
| IUPAC Name | bis(1,3-dipropylcyclohexa-2,4-dien-1-yl) 7,7-dimethylbicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate |
| SMILES | CCCC1=CC(CCC)(OC(=O)C2C(C(=O)OC3(CCC)C=C(CCC)C=CC3)C3C=CC2C3(C)C)CC=C1 |
| InChI | InChI=1S/C35H50O4/c1-7-13-25-15-11-21-34(23-25,19-9-3)38-31(36)29-27-17-18-28(33(27,5)6)30(29)32(37)39-35(20-10-4)22-12-16-26(24-35)14-8-2/h11-12,15-18,23-24,27-30H,7-10,13-14,19-22H2,1-6H3 |
| InChIKey | IEEZKXAOTUCCKV-UHFFFAOYSA-N |
| XLogP | 8.60 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.78 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|