C10H13NO — CID 142750657
2-methyl-4,5,6,7-tetrahydro-1H-indole-4-carbaldehyde (PubChem CID 142750657) has the molecular formula C10H13NO and a molecular weight of 163.22 g/mol. Its IUPAC name is 2-methyl-4,5,6,7-tetrahydro-1H-indole-4-carbaldehyde.
| Compound Name | 2-methyl-4,5,6,7-tetrahydro-1H-indole-4-carbaldehyde |
|---|---|
| PubChem CID | 142750657 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | 2-methyl-4,5,6,7-tetrahydro-1H-indole-4-carbaldehyde |
| SMILES | Cc1cc2c([nH]1)CCCC2C=O |
| InChI | InChI=1S/C10H13NO/c1-7-5-9-8(6-12)3-2-4-10(9)11-7/h5-6,8,11H,2-4H2,1H3 |
| InChIKey | QXHWLFAQJGIJRL-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|