C20H30N4O5 — CID 142750666
tert-butyl 4-[[3-[(E)-4-ethoxy-4-oxobut-2-enoxy]pyrazin-2-yl]amino]piperidine-1-carboxylate (PubChem CID 142750666) has the molecular formula C20H30N4O5 and a molecular weight of 406.48 g/mol. Its IUPAC name is tert-butyl 4-[[3-[(E)-4-ethoxy-4-oxobut-2-enoxy]pyrazin-2-yl]amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[3-[(E)-4-ethoxy-4-oxobut-2-enoxy]pyrazin-2-yl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 142750666 |
| Molecular Formula | C20H30N4O5 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.22 |
| IUPAC Name | tert-butyl 4-[[3-[(E)-4-ethoxy-4-oxobut-2-enoxy]pyrazin-2-yl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)/C=C/COc1nccnc1NC1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C20H30N4O5/c1-5-27-16(25)7-6-14-28-18-17(21-10-11-22-18)23-15-8-12-24(13-9-15)19(26)29-20(2,3)4/h6-7,10-11,15H,5,8-9,12-14H2,1-4H3,(H,21,23)/b7-6+ |
| InChIKey | XQDPZGVITPJOAM-VOTSOKGWSA-N |
| XLogP | 2.79 |
| TPSA | 102.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|