C13H24O3Si — CID 142751993
(1R,5R)-5-[tert-butyl(dimethyl)silyl]oxycyclohex-3-ene-1-carboxylic acid (PubChem CID 142751993) has the molecular formula C13H24O3Si and a molecular weight of 256.42 g/mol. Its IUPAC name is (1R,5R)-5-[tert-butyl(dimethyl)silyl]oxycyclohex-3-ene-1-carboxylic acid.
| Compound Name | (1R,5R)-5-[tert-butyl(dimethyl)silyl]oxycyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 142751993 |
| Molecular Formula | C13H24O3Si |
| Molecular Weight | 256.42 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | (1R,5R)-5-[tert-butyl(dimethyl)silyl]oxycyclohex-3-ene-1-carboxylic acid |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1C=CC[C@@H](C(=O)O)C1 |
| InChI | InChI=1S/C13H24O3Si/c1-13(2,3)17(4,5)16-11-8-6-7-10(9-11)12(14)15/h6,8,10-11H,7,9H2,1-5H3,(H,14,15)/t10-,11+/m1/s1 |
| InChIKey | ZXYBIOZYVZBZSO-MNOVXSKESA-N |
| XLogP | 3.43 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.42 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|