C13H14O2S2 — CID 142756789
1-(5-benzoyl-1,3-dithian-5-yl)ethanone (PubChem CID 142756789) has the molecular formula C13H14O2S2 and a molecular weight of 266.39 g/mol. Its IUPAC name is 1-(5-benzoyl-1,3-dithian-5-yl)ethanone.
| Compound Name | 1-(5-benzoyl-1,3-dithian-5-yl)ethanone |
|---|---|
| PubChem CID | 142756789 |
| Molecular Formula | C13H14O2S2 |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.04 |
| IUPAC Name | 1-(5-benzoyl-1,3-dithian-5-yl)ethanone |
| SMILES | CC(=O)C1(C(=O)c2ccccc2)CSCSC1 |
| InChI | InChI=1S/C13H14O2S2/c1-10(14)13(7-16-9-17-8-13)12(15)11-5-3-2-4-6-11/h2-6H,7-9H2,1H3 |
| InChIKey | APMARPQKSCPRGK-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|