C24H38O4 — CID 142764708
(9Z,12Z,15Z)-2-ethyl-2-(2-methylprop-2-enoyloxy)octadeca-9,12,15-trienoic acid (PubChem CID 142764708) has the molecular formula C24H38O4 and a molecular weight of 390.56 g/mol. Its IUPAC name is (9Z,12Z,15Z)-2-ethyl-2-(2-methylprop-2-enoyloxy)octadeca-9,12,15-trienoic acid.
| Compound Name | (9Z,12Z,15Z)-2-ethyl-2-(2-methylprop-2-enoyloxy)octadeca-9,12,15-trienoic acid |
|---|---|
| PubChem CID | 142764708 |
| Molecular Formula | C24H38O4 |
| Molecular Weight | 390.56 g/mol |
| Exact Mass | 390.28 |
| IUPAC Name | (9Z,12Z,15Z)-2-ethyl-2-(2-methylprop-2-enoyloxy)octadeca-9,12,15-trienoic acid |
| SMILES | C=C(C)C(=O)OC(CC)(CCCCCC/C=C\C/C=C\C/C=C\CC)C(=O)O |
| InChI | InChI=1S/C24H38O4/c1-5-7-8-9-10-11-12-13-14-15-16-17-18-19-20-24(6-2,23(26)27)28-22(25)21(3)4/h7-8,10-11,13-14H,3,5-6,9,12,15-20H2,1-2,4H3,(H,26,27)/b8-7-,11-10-,14-13- |
| InChIKey | IYZXEQBQDGUQLX-JPFHKJGASA-N |
| XLogP | 6.54 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.56 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|