C16H23NO4 — CID 142769843
[1-[ethyl(2-hydroxyethyl)amino]-1-oxopropan-2-yl] 4-ethylbenzoate (PubChem CID 142769843) has the molecular formula C16H23NO4 and a molecular weight of 293.36 g/mol. Its IUPAC name is [1-[ethyl(2-hydroxyethyl)amino]-1-oxopropan-2-yl] 4-ethylbenzoate.
| Compound Name | [1-[ethyl(2-hydroxyethyl)amino]-1-oxopropan-2-yl] 4-ethylbenzoate |
|---|---|
| PubChem CID | 142769843 |
| Molecular Formula | C16H23NO4 |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | [1-[ethyl(2-hydroxyethyl)amino]-1-oxopropan-2-yl] 4-ethylbenzoate |
| SMILES | CCc1ccc(C(=O)OC(C)C(=O)N(CC)CCO)cc1 |
| InChI | InChI=1S/C16H23NO4/c1-4-13-6-8-14(9-7-13)16(20)21-12(3)15(19)17(5-2)10-11-18/h6-9,12,18H,4-5,10-11H2,1-3H3 |
| InChIKey | WZCGVNIXHDRQHX-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |