About [1-(diethylamino)-1-oxopropan-2-yl] 3-aminobenzoate
[1-(diethylamino)-1-oxopropan-2-yl] 3-aminobenzoate (PubChem CID 60720897) has the molecular formula C14H20N2O3
and a molecular weight of 264.32 g/mol. Its IUPAC name is [1-(diethylamino)-1-oxopropan-2-yl] 3-aminobenzoate.
Molecular Properties
| Compound Name | [1-(diethylamino)-1-oxopropan-2-yl] 3-aminobenzoate |
| PubChem CID | 60720897 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | [1-(diethylamino)-1-oxopropan-2-yl] 3-aminobenzoate |
| SMILES | CCN(CC)C(=O)C(C)OC(=O)c1cccc(N)c1 |
| InChI | InChI=1S/C14H20N2O3/c1-4-16(5-2)13(17)10(3)19-14(18)11-7-6-8-12(15)9-11/h6-10H,4-5,15H2,1-3H3 |
| InChIKey | IFAYTMJXMWBEJA-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze [1-(diethylamino)-1-oxopropan-2-yl] 3-aminobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(diethylamino)-1-oxopropan-2-yl] 3-aminobenzoate?
The IUPAC name of [1-(diethylamino)-1-oxopropan-2-yl] 3-aminobenzoate (CID 60720897) is [1-(diethylamino)-1-oxopropan-2-yl] 3-aminobenzoate.
What is the SMILES notation for [1-(diethylamino)-1-oxopropan-2-yl] 3-aminobenzoate?
The canonical SMILES for [1-(diethylamino)-1-oxopropan-2-yl] 3-aminobenzoate is CCN(CC)C(=O)C(C)OC(=O)c1cccc(N)c1.
What is the InChIKey of [1-(diethylamino)-1-oxopropan-2-yl] 3-aminobenzoate?
The InChIKey is IFAYTMJXMWBEJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N2O3/c1-4-16(5-2)13(17)10(3)19-14(18)11-7-6-8-12(15)9-11/h6-10H,4-5,15H2,1-3H3.
What are the key properties of [1-(diethylamino)-1-oxopropan-2-yl] 3-aminobenzoate?
[1-(diethylamino)-1-oxopropan-2-yl] 3-aminobenzoate has a molecular weight of 264.32 g/mol, XLogP of 1.68, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(diethylamino)-1-oxopropan-2-yl] 3-aminobenzoate is sourced from PubChem (CID 60720897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).