C26H43N5O — CID 142778289
2,3-bis(4-propan-2-ylpiperazin-1-yl)-4-(pyrrolidin-1-ylmethyl)benzaldehyde (PubChem CID 142778289) has the molecular formula C26H43N5O and a molecular weight of 441.66 g/mol. Its IUPAC name is 2,3-bis(4-propan-2-ylpiperazin-1-yl)-4-(pyrrolidin-1-ylmethyl)benzaldehyde.
| Compound Name | 2,3-bis(4-propan-2-ylpiperazin-1-yl)-4-(pyrrolidin-1-ylmethyl)benzaldehyde |
|---|---|
| PubChem CID | 142778289 |
| Molecular Formula | C26H43N5O |
| Molecular Weight | 441.66 g/mol |
| Exact Mass | 441.35 |
| IUPAC Name | 2,3-bis(4-propan-2-ylpiperazin-1-yl)-4-(pyrrolidin-1-ylmethyl)benzaldehyde |
| SMILES | CC(C)N1CCN(c2c(C=O)ccc(CN3CCCC3)c2N2CCN(C(C)C)CC2)CC1 |
| InChI | InChI=1S/C26H43N5O/c1-21(2)28-11-15-30(16-12-28)25-23(19-27-9-5-6-10-27)7-8-24(20-32)26(25)31-17-13-29(14-18-31)22(3)4/h7-8,20-22H,5-6,9-19H2,1-4H3 |
| InChIKey | FXTHMDQHOLWPCW-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 33.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.66 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|