C23H25ClN4O2Si — CID 142787464
5-chloro-3-[[3-[2-[ethyl(dimethyl)silyl]ethynyl]-2-pyridinyl]amino]-1-[(4-methoxyphenyl)methyl]pyrazin-2-one (PubChem CID 142787464) has the molecular formula C23H25ClN4O2Si and a molecular weight of 453.02 g/mol. Its IUPAC name is 5-chloro-3-[[3-[2-[ethyl(dimethyl)silyl]ethynyl]-2-pyridinyl]amino]-1-[(4-methoxyphenyl)methyl]pyrazin-2-one.
| Compound Name | 5-chloro-3-[[3-[2-[ethyl(dimethyl)silyl]ethynyl]-2-pyridinyl]amino]-1-[(4-methoxyphenyl)methyl]pyrazin-2-one |
|---|---|
| PubChem CID | 142787464 |
| Molecular Formula | C23H25ClN4O2Si |
| Molecular Weight | 453.02 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | 5-chloro-3-[[3-[2-[ethyl(dimethyl)silyl]ethynyl]-2-pyridinyl]amino]-1-[(4-methoxyphenyl)methyl]pyrazin-2-one |
| SMILES | CC[Si](C)(C)C#Cc1cccnc1Nc1nc(Cl)cn(Cc2ccc(OC)cc2)c1=O |
| InChI | InChI=1S/C23H25ClN4O2Si/c1-5-31(3,4)14-12-18-7-6-13-25-21(18)27-22-23(29)28(16-20(24)26-22)15-17-8-10-19(30-2)11-9-17/h6-11,13,16H,5,15H2,1-4H3,(H,25,26,27) |
| InChIKey | MFUCYQJWFJBQDS-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.02 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|