C21H25ClN2O2S — CID 14278854
ethyl 2-[7-chloro-10-[2-(dimethylamino)propyl]phenothiazin-2-yl]acetate (PubChem CID 14278854) has the molecular formula C21H25ClN2O2S and a molecular weight of 404.96 g/mol. Its IUPAC name is ethyl 2-[7-chloro-10-[2-(dimethylamino)propyl]phenothiazin-2-yl]acetate.
| Compound Name | ethyl 2-[7-chloro-10-[2-(dimethylamino)propyl]phenothiazin-2-yl]acetate |
|---|---|
| PubChem CID | 14278854 |
| Molecular Formula | C21H25ClN2O2S |
| Molecular Weight | 404.96 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | ethyl 2-[7-chloro-10-[2-(dimethylamino)propyl]phenothiazin-2-yl]acetate |
| SMILES | CCOC(=O)Cc1ccc2c(c1)N(CC(C)N(C)C)c1ccc(Cl)cc1S2 |
| InChI | InChI=1S/C21H25ClN2O2S/c1-5-26-21(25)11-15-6-9-19-18(10-15)24(13-14(2)23(3)4)17-8-7-16(22)12-20(17)27-19/h6-10,12,14H,5,11,13H2,1-4H3 |
| InChIKey | GNOLPVFNCDQPDB-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.96 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |