C22H22ClN7O2 — CID 142788989
5-chloro-4-(6-methoxy-3-pyridinyl)-3-[2-methyl-9-(oxan-2-yl)purin-6-yl]pyridin-2-amine (PubChem CID 142788989) has the molecular formula C22H22ClN7O2 and a molecular weight of 451.92 g/mol. Its IUPAC name is 5-chloro-4-(6-methoxy-3-pyridinyl)-3-[2-methyl-9-(oxan-2-yl)purin-6-yl]pyridin-2-amine.
| Compound Name | 5-chloro-4-(6-methoxy-3-pyridinyl)-3-[2-methyl-9-(oxan-2-yl)purin-6-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 142788989 |
| Molecular Formula | C22H22ClN7O2 |
| Molecular Weight | 451.92 g/mol |
| Exact Mass | 451.15 |
| IUPAC Name | 5-chloro-4-(6-methoxy-3-pyridinyl)-3-[2-methyl-9-(oxan-2-yl)purin-6-yl]pyridin-2-amine |
| SMILES | COc1ccc(-c2c(Cl)cnc(N)c2-c2nc(C)nc3c2ncn3C2CCCCO2)cn1 |
| InChI | InChI=1S/C22H22ClN7O2/c1-12-28-19(20-22(29-12)30(11-27-20)16-5-3-4-8-32-16)18-17(14(23)10-26-21(18)24)13-6-7-15(31-2)25-9-13/h6-7,9-11,16H,3-5,8H2,1-2H3,(H2,24,26) |
| InChIKey | GFZFLFLEBVCXRP-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 113.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.92 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |