C12H17N — CID 142804209
5-ethyl-6-methyl-2,3-dihydro-1H-inden-2-amine (PubChem CID 142804209) has the molecular formula C12H17N and a molecular weight of 175.27 g/mol. Its IUPAC name is 5-ethyl-6-methyl-2,3-dihydro-1H-inden-2-amine.
| Compound Name | 5-ethyl-6-methyl-2,3-dihydro-1H-inden-2-amine |
|---|---|
| PubChem CID | 142804209 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.27 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | 5-ethyl-6-methyl-2,3-dihydro-1H-inden-2-amine |
| SMILES | CCc1cc2c(cc1C)CC(N)C2 |
| InChI | InChI=1S/C12H17N/c1-3-9-5-11-7-12(13)6-10(11)4-8(9)2/h4-5,12H,3,6-7,13H2,1-2H3 |
| InChIKey | MVXUNMMMNQHDEY-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.27 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |