C11H14N2O3 — CID 166126085
2-amino-6-(2-nitroethyl)-2,3-dihydro-1H-inden-5-ol (PubChem CID 166126085) has the molecular formula C11H14N2O3 and a molecular weight of 222.24 g/mol. Its IUPAC name is 2-amino-6-(2-nitroethyl)-2,3-dihydro-1H-inden-5-ol.
| Compound Name | 2-amino-6-(2-nitroethyl)-2,3-dihydro-1H-inden-5-ol |
|---|---|
| PubChem CID | 166126085 |
| Molecular Formula | C11H14N2O3 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | 2-amino-6-(2-nitroethyl)-2,3-dihydro-1H-inden-5-ol |
| SMILES | NC1Cc2cc(O)c(CC[N+](=O)[O-])cc2C1 |
| InChI | InChI=1S/C11H14N2O3/c12-10-4-8-3-7(1-2-13(15)16)11(14)6-9(8)5-10/h3,6,10,14H,1-2,4-5,12H2 |
| InChIKey | DJCJLXWIFZKHFQ-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 89.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|