C7H11N2+ — CID 142810852
(6-imino-1-methylcyclohexa-2,4-dien-1-yl)azanium (PubChem CID 142810852) has the molecular formula C7H11N2+ and a molecular weight of 123.18 g/mol. Its IUPAC name is (6-imino-1-methylcyclohexa-2,4-dien-1-yl)azanium.
| Compound Name | (6-imino-1-methylcyclohexa-2,4-dien-1-yl)azanium |
|---|---|
| PubChem CID | 142810852 |
| Molecular Formula | C7H11N2+ |
| Molecular Weight | 123.18 g/mol |
| Exact Mass | 123.09 |
| IUPAC Name | (6-imino-1-methylcyclohexa-2,4-dien-1-yl)azanium |
| SMILES | [H]/N=C1\C=CC=CC1(C)[NH3+] |
| InChI | InChI=1S/C7H10N2/c1-7(9)5-3-2-4-6(7)8/h2-5,8H,9H2,1H3/p+1/b8-6+ |
| InChIKey | MIMRASLRPMSOGM-SOFGYWHQSA-O |
| XLogP | 0.13 |
| TPSA | 51.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 123.18 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|