C8H10BrN — CID 143545839
7-bromo-2,2-dimethylazepine (PubChem CID 143545839) has the molecular formula C8H10BrN and a molecular weight of 200.08 g/mol. Its IUPAC name is 7-bromo-2,2-dimethylazepine.
| Compound Name | 7-bromo-2,2-dimethylazepine |
|---|---|
| PubChem CID | 143545839 |
| Molecular Formula | C8H10BrN |
| Molecular Weight | 200.08 g/mol |
| Exact Mass | 199.00 |
| IUPAC Name | 7-bromo-2,2-dimethylazepine |
| SMILES | CC1(C)C=CC=CC(Br)=N1 |
| InChI | InChI=1S/C8H10BrN/c1-8(2)6-4-3-5-7(9)10-8/h3-6H,1-2H3 |
| InChIKey | YHORSKDUSICKMS-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.08 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |