C23H28N2O2 — CID 177145005
3-[(1E)-1-(6-iminocyclohexa-2,4-dien-1-ylidene)-2-methylpropyl]-3-azatetracyclo[8.4.0.01,5.05,10]tetradecane-2,4-dione (PubChem CID 177145005) has the molecular formula C23H28N2O2 and a molecular weight of 364.49 g/mol. Its IUPAC name is 3-[(1E)-1-(6-iminocyclohexa-2,4-dien-1-ylidene)-2-methylpropyl]-3-azatetracyclo[8.4.0.01,5.05,10]tetradecane-2,4-dione.
| Compound Name | 3-[(1E)-1-(6-iminocyclohexa-2,4-dien-1-ylidene)-2-methylpropyl]-3-azatetracyclo[8.4.0.01,5.05,10]tetradecane-2,4-dione |
|---|---|
| PubChem CID | 177145005 |
| Molecular Formula | C23H28N2O2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | 3-[(1E)-1-(6-iminocyclohexa-2,4-dien-1-ylidene)-2-methylpropyl]-3-azatetracyclo[8.4.0.01,5.05,10]tetradecane-2,4-dione |
| SMILES | [H]/N=C1\C=CC=C\C1=C(\C(C)C)N1C(=O)C23CCCCC24CCCCC43C1=O |
| InChI | InChI=1S/C23H28N2O2/c1-15(2)18(16-9-3-4-10-17(16)24)25-19(26)22-13-7-5-11-21(22)12-6-8-14-23(21,22)20(25)27/h3-4,9-10,15,24H,5-8,11-14H2,1-2H3/b18-16+,24-17+ |
| InChIKey | LDWZQDQOCSUSRO-QYOURPMQSA-N |
| XLogP | 4.53 |
| TPSA | 61.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|