C13H22N2 — CID 142817935
1-[(1E,3Z,5Z)-4-methylocta-1,3,5-trienyl]piperazine (PubChem CID 142817935) has the molecular formula C13H22N2 and a molecular weight of 206.33 g/mol. Its IUPAC name is 1-[(1E,3Z,5Z)-4-methylocta-1,3,5-trienyl]piperazine.
| Compound Name | 1-[(1E,3Z,5Z)-4-methylocta-1,3,5-trienyl]piperazine |
|---|---|
| PubChem CID | 142817935 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | 1-[(1E,3Z,5Z)-4-methylocta-1,3,5-trienyl]piperazine |
| SMILES | CC/C=C\C(C)=C/C=C/N1CCNCC1 |
| InChI | InChI=1S/C13H22N2/c1-3-4-6-13(2)7-5-10-15-11-8-14-9-12-15/h4-7,10,14H,3,8-9,11-12H2,1-2H3/b6-4-,10-5+,13-7- |
| InChIKey | AKTNHYBFCOZRDZ-VALXZISOSA-N |
| XLogP | 2.32 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|