C11H20N2 — CID 15665728
1-methyl-4-[(1E,3E)-2-methylpenta-1,3-dienyl]piperazine (PubChem CID 15665728) has the molecular formula C11H20N2 and a molecular weight of 180.29 g/mol. Its IUPAC name is 1-methyl-4-[(1E,3E)-2-methylpenta-1,3-dienyl]piperazine.
| Compound Name | 1-methyl-4-[(1E,3E)-2-methylpenta-1,3-dienyl]piperazine |
|---|---|
| PubChem CID | 15665728 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | 1-methyl-4-[(1E,3E)-2-methylpenta-1,3-dienyl]piperazine |
| SMILES | C/C=C/C(C)=C/N1CCN(C)CC1 |
| InChI | InChI=1S/C11H20N2/c1-4-5-11(2)10-13-8-6-12(3)7-9-13/h4-5,10H,6-9H2,1-3H3/b5-4+,11-10+ |
| InChIKey | AJBPEIOSORDDRS-PMXBNEBOSA-N |
| XLogP | 1.71 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|